C10H18N4 — CID 176564513
(Z,Z)-N'-methylidene-N-[(4-methylpiperazin-1-yl)methyl]prop-2-ene-1,3-diimine (PubChem CID 176564513) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (Z,Z)-N'-methylidene-N-[(4-methylpiperazin-1-yl)methyl]prop-2-ene-1,3-diimine.
| Compound Name | (Z,Z)-N'-methylidene-N-[(4-methylpiperazin-1-yl)methyl]prop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 176564513 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (Z,Z)-N'-methylidene-N-[(4-methylpiperazin-1-yl)methyl]prop-2-ene-1,3-diimine |
| SMILES | C=N/C=C\C=N/CN1CCN(C)CC1 |
| InChI | InChI=1S/C10H18N4/c1-11-4-3-5-12-10-14-8-6-13(2)7-9-14/h3-5H,1,6-10H2,2H3/b4-3-,12-5- |
| InChIKey | UBMVYIJSPBRCEP-HVSXSXIDSA-N |
| XLogP | 0.48 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|