C11H20N4 — CID 143497005
(1E,3Z)-4-[(Z)-ethylideneamino]-4-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine (PubChem CID 143497005) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is (1E,3Z)-4-[(Z)-ethylideneamino]-4-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-4-[(Z)-ethylideneamino]-4-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143497005 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | (1E,3Z)-4-[(Z)-ethylideneamino]-4-(4-methylpiperazin-1-yl)buta-1,3-dien-1-amine |
| SMILES | C/C=N\C(=C/C=C/N)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N4/c1-3-13-11(5-4-6-12)15-9-7-14(2)8-10-15/h3-6H,7-10,12H2,1-2H3/b6-4+,11-5+,13-3- |
| InChIKey | YEKPHLWWRZDUOV-XYDBIFOWSA-N |
| XLogP | 0.64 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|