C10H16N4 — CID 142128668
2-(4-methylpiperazin-1-yl)-4H-1,3-diazepine (PubChem CID 142128668) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-4H-1,3-diazepine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-4H-1,3-diazepine |
|---|---|
| PubChem CID | 142128668 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-4H-1,3-diazepine |
| SMILES | CN1CCN(C2=NCC=CC=N2)CC1 |
| InChI | InChI=1S/C10H16N4/c1-13-6-8-14(9-7-13)10-11-4-2-3-5-12-10/h2-4H,5-9H2,1H3 |
| InChIKey | BLOFYTMIBPLTID-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |