C11H21N4+ — CID 156866754
N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide (PubChem CID 156866754) has the molecular formula C11H21N4+ and a molecular weight of 209.32 g/mol. Its IUPAC name is N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide.
| Compound Name | N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide |
|---|---|
| PubChem CID | 156866754 |
| Molecular Formula | C11H21N4+ |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide |
| SMILES | [H]/N=C/N=C(/C=C\C)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C11H21N4/c1-4-5-11(13-10-12)14-6-8-15(2,3)9-7-14/h4-5,10,12H,6-9H2,1-3H3/q+1/b5-4-,12-10+,13-11- |
| InChIKey | HVDRIOSFKQAXKO-QQOZQRDASA-N |
| XLogP | 0.96 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|