C15H26N6 — CID 123903463
(2E)-N-[1-amino-3-imino-3-(4-methylpiperazin-1-yl)propylidene]-N'-methylhexa-2,4-dienimidamide (PubChem CID 123903463) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2E)-N-[1-amino-3-imino-3-(4-methylpiperazin-1-yl)propylidene]-N'-methylhexa-2,4-dienimidamide.
| Compound Name | (2E)-N-[1-amino-3-imino-3-(4-methylpiperazin-1-yl)propylidene]-N'-methylhexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 123903463 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2E)-N-[1-amino-3-imino-3-(4-methylpiperazin-1-yl)propylidene]-N'-methylhexa-2,4-dienimidamide |
| SMILES | [H]/N=C(/C/C(N)=N/C(/C=C/C=CC)=N/C)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H26N6/c1-4-5-6-7-15(18-2)19-13(16)12-14(17)21-10-8-20(3)9-11-21/h4-7,17H,8-12H2,1-3H3,(H2,16,18,19)/b5-4?,7-6+,17-14- |
| InChIKey | IYYUKHDGHXEEQZ-UIZUNLLISA-N |
| XLogP | 1.12 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|