C15H33N4+ — CID 156866753
N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide;ethane (PubChem CID 156866753) has the molecular formula C15H33N4+ and a molecular weight of 269.46 g/mol. Its IUPAC name is N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide;ethane.
| Compound Name | N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide;ethane |
|---|---|
| PubChem CID | 156866753 |
| Molecular Formula | C15H33N4+ |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N-[(Z)-1-(4,4-dimethylpiperazin-4-ium-1-yl)but-2-enylidene]methanimidamide;ethane |
| SMILES | CC.CC.[H]/N=C/N=C(/C=C\C)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C11H21N4.2C2H6/c1-4-5-11(13-10-12)14-6-8-15(2,3)9-7-14;2*1-2/h4-5,10,12H,6-9H2,1-3H3;2*1-2H3/q+1;;/b5-4-,12-10+,13-11-;; |
| InChIKey | PUCBRFUNVPNZQZ-JSWDTAMPSA-N |
| XLogP | 3.01 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|