C12H22N4 — CID 176666498
(Z)-1-(4-butan-2-ylpiperazin-1-yl)but-2-ene-1,4-diimine (PubChem CID 176666498) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is (Z)-1-(4-butan-2-ylpiperazin-1-yl)but-2-ene-1,4-diimine.
| Compound Name | (Z)-1-(4-butan-2-ylpiperazin-1-yl)but-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 176666498 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (Z)-1-(4-butan-2-ylpiperazin-1-yl)but-2-ene-1,4-diimine |
| SMILES | [H]/N=C/C=C\C(=N/[H])N1CCN(C(C)CC)CC1 |
| InChI | InChI=1S/C12H22N4/c1-3-11(2)15-7-9-16(10-8-15)12(14)5-4-6-13/h4-6,11,13-14H,3,7-10H2,1-2H3/b5-4-,13-6+,14-12+ |
| InChIKey | SUCHHANCHCLSIJ-URDUZRCCSA-N |
| XLogP | 1.59 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|