C15H32N4 — CID 143703394
N,N'-diethyl-1-piperazin-1-ylethane-1,2-diimine;ethane;prop-1-ene (PubChem CID 143703394) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is N,N'-diethyl-1-piperazin-1-ylethane-1,2-diimine;ethane;prop-1-ene.
| Compound Name | N,N'-diethyl-1-piperazin-1-ylethane-1,2-diimine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143703394 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | N,N'-diethyl-1-piperazin-1-ylethane-1,2-diimine;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC/N=C/C(=N\CC)N1CCNCC1 |
| InChI | InChI=1S/C10H20N4.C3H6.C2H6/c1-3-11-9-10(13-4-2)14-7-5-12-6-8-14;1-3-2;1-2/h9,12H,3-8H2,1-2H3;3H,1H2,2H3;1-2H3/b11-9+,13-10+;; |
| InChIKey | OINTWMDOPGARNA-ULRVTDAOSA-N |
| XLogP | 2.62 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|