C9H18N4 — CID 145241375
(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide (PubChem CID 145241375) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is (Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide.
| Compound Name | (Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 145241375 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide |
| SMILES | C/N=C(N)/C=C\CN1CCNCC1 |
| InChI | InChI=1S/C9H18N4/c1-11-9(10)3-2-6-13-7-4-12-5-8-13/h2-3,12H,4-8H2,1H3,(H2,10,11)/b3-2- |
| InChIKey | LBMUMHFRNAGQEN-IHWYPQMZSA-N |
| XLogP | -0.57 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|