About acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide
acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide (PubChem CID 145241374) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide.
Molecular Properties
| Compound Name | acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide |
| PubChem CID | 145241374 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide |
| SMILES | C#C.C/N=C(N)/C=C\CN1CCNCC1 |
| InChI | InChI=1S/C9H18N4.C2H2/c1-11-9(10)3-2-6-13-7-4-12-5-8-13;1-2/h2-3,12H,4-8H2,1H3,(H2,10,11);1-2H/b3-2-; |
| InChIKey | JBVJTRPEIRMDOW-OLGQORCHSA-N |
| XLogP | -0.32 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide?
The IUPAC name of acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide (CID 145241374) is acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide.
What is the SMILES notation for acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide?
The canonical SMILES for acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide is C#C.C/N=C(N)/C=C\CN1CCNCC1.
What is the InChIKey of acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide?
The InChIKey is JBVJTRPEIRMDOW-OLGQORCHSA-N. The full InChI is InChI=1S/C9H18N4.C2H2/c1-11-9(10)3-2-6-13-7-4-12-5-8-13;1-2/h2-3,12H,4-8H2,1H3,(H2,10,11);1-2H/b3-2-;.
What are the key properties of acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide?
acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide has a molecular weight of 208.31 g/mol, XLogP of -0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(Z)-N'-methyl-4-piperazin-1-ylbut-2-enimidamide is sourced from PubChem (CID 145241374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).