About (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide
(Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide (PubChem CID 142291131) has the molecular formula C10H20N4O
and a molecular weight of 212.30 g/mol. Its IUPAC name is (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide |
| PubChem CID | 142291131 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide |
| SMILES | C/N=C(N)/C=C\NCCN1CCOCC1 |
| InChI | InChI=1S/C10H20N4O/c1-12-10(11)2-3-13-4-5-14-6-8-15-9-7-14/h2-3,13H,4-9H2,1H3,(H2,11,12)/b3-2- |
| InChIKey | UEEIUSHFGAMEDH-IHWYPQMZSA-N |
| XLogP | -0.59 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide?
The IUPAC name of (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide (CID 142291131) is (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide.
What is the SMILES notation for (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide?
The canonical SMILES for (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide is C/N=C(N)/C=C\NCCN1CCOCC1.
What is the InChIKey of (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide?
The InChIKey is UEEIUSHFGAMEDH-IHWYPQMZSA-N. The full InChI is InChI=1S/C10H20N4O/c1-12-10(11)2-3-13-4-5-14-6-8-15-9-7-14/h2-3,13H,4-9H2,1H3,(H2,11,12)/b3-2-.
What are the key properties of (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide?
(Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide has a molecular weight of 212.30 g/mol, XLogP of -0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-methyl-3-(2-morpholin-4-ylethylamino)prop-2-enimidamide is sourced from PubChem (CID 142291131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).