C22H26ClNO4 — CID 171848878
(3S)-1-(5-chloro-4-cyclobutyloxy-2-methyl-N-prop-2-ynoylanilino)-3-methylcyclohexane-1-carboxylic acid (PubChem CID 171848878) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is (3S)-1-(5-chloro-4-cyclobutyloxy-2-methyl-N-prop-2-ynoylanilino)-3-methylcyclohexane-1-carboxylic acid.
| Compound Name | (3S)-1-(5-chloro-4-cyclobutyloxy-2-methyl-N-prop-2-ynoylanilino)-3-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171848878 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (3S)-1-(5-chloro-4-cyclobutyloxy-2-methyl-N-prop-2-ynoylanilino)-3-methylcyclohexane-1-carboxylic acid |
| SMILES | C#CC(=O)N(c1cc(Cl)c(OC2CCC2)cc1C)C1(C(=O)O)CCC[C@H](C)C1 |
| InChI | InChI=1S/C22H26ClNO4/c1-4-20(25)24(22(21(26)27)10-6-7-14(2)13-22)18-12-17(23)19(11-15(18)3)28-16-8-5-9-16/h1,11-12,14,16H,5-10,13H2,2-3H3,(H,26,27)/t14-,22?/m0/s1 |
| InChIKey | DZSAJZFTDHMNEL-XLEXHMCLSA-N |
| XLogP | 4.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|