C21H12F4N4O — CID 171850779
4-[4-fluoro-3-(trifluoromethyl)phenoxy]-6-(1H-indol-6-ylamino)pyridine-2-carbonitrile (PubChem CID 171850779) has the molecular formula C21H12F4N4O and a molecular weight of 412.35 g/mol. Its IUPAC name is 4-[4-fluoro-3-(trifluoromethyl)phenoxy]-6-(1H-indol-6-ylamino)pyridine-2-carbonitrile.
| Compound Name | 4-[4-fluoro-3-(trifluoromethyl)phenoxy]-6-(1H-indol-6-ylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171850779 |
| Molecular Formula | C21H12F4N4O |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-[4-fluoro-3-(trifluoromethyl)phenoxy]-6-(1H-indol-6-ylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(Oc2ccc(F)c(C(F)(F)F)c2)cc(Nc2ccc3cc[nH]c3c2)n1 |
| InChI | InChI=1S/C21H12F4N4O/c22-18-4-3-15(9-17(18)21(23,24)25)30-16-7-14(11-26)29-20(10-16)28-13-2-1-12-5-6-27-19(12)8-13/h1-10,27H,(H,28,29) |
| InChIKey | PQEKPTUYURKBPY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |