C20H11F3N4O — CID 171850874
6-(1H-indol-6-ylamino)-4-(2,3,5-trifluorophenoxy)pyridine-2-carbonitrile (PubChem CID 171850874) has the molecular formula C20H11F3N4O and a molecular weight of 380.33 g/mol. Its IUPAC name is 6-(1H-indol-6-ylamino)-4-(2,3,5-trifluorophenoxy)pyridine-2-carbonitrile.
| Compound Name | 6-(1H-indol-6-ylamino)-4-(2,3,5-trifluorophenoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171850874 |
| Molecular Formula | C20H11F3N4O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 6-(1H-indol-6-ylamino)-4-(2,3,5-trifluorophenoxy)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(Oc2cc(F)cc(F)c2F)cc(Nc2ccc3cc[nH]c3c2)n1 |
| InChI | InChI=1S/C20H11F3N4O/c21-12-5-16(22)20(23)18(6-12)28-15-7-14(10-24)27-19(9-15)26-13-2-1-11-3-4-25-17(11)8-13/h1-9,25H,(H,26,27) |
| InChIKey | UWNSNBUWBHJINC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|