C16H21Cl2N3O — CID 17185082
4-cyclopentyl-N-(2,3-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 17185082) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is 4-cyclopentyl-N-(2,3-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-(2,3-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17185082 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-cyclopentyl-N-(2,3-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O/c17-13-6-3-7-14(15(13)18)19-16(22)21-10-8-20(9-11-21)12-4-1-2-5-12/h3,6-7,12H,1-2,4-5,8-11H2,(H,19,22) |
| InChIKey | OHDDJEJPGRVPJO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |