About 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide
4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide (PubChem CID 112825337) has the molecular formula C22H27N3O
and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide |
| PubChem CID | 112825337 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc2c3c(cccc13)CC2)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C22H27N3O/c26-22(25-14-12-24(13-15-25)18-5-1-2-6-18)23-20-11-10-17-9-8-16-4-3-7-19(20)21(16)17/h3-4,7,10-11,18H,1-2,5-6,8-9,12-15H2,(H,23,26) |
| InChIKey | KTHQFPGGOUTWPB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide?
The IUPAC name of 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide (CID 112825337) is 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide.
What is the SMILES notation for 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide?
The canonical SMILES for 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide is O=C(Nc1ccc2c3c(cccc13)CC2)N1CCN(C2CCCC2)CC1.
What is the InChIKey of 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide?
The InChIKey is KTHQFPGGOUTWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O/c26-22(25-14-12-24(13-15-25)18-5-1-2-6-18)23-20-11-10-17-9-8-16-4-3-7-19(20)21(16)17/h3-4,7,10-11,18H,1-2,5-6,8-9,12-15H2,(H,23,26).
What are the key properties of 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide?
4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide has a molecular weight of 349.48 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-N-(1,2-dihydroacenaphthylen-5-yl)piperazine-1-carboxamide is sourced from PubChem (CID 112825337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).