C23H31ClN6 — CID 171851334
2-N-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 171851334) has the molecular formula C23H31ClN6 and a molecular weight of 427.00 g/mol. Its IUPAC name is 2-N-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171851334 |
| Molecular Formula | C23H31ClN6 |
| Molecular Weight | 427.00 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-N-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)-6-pyrrolidin-1-yl-2H-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1cc(C)cc(N2C(N3CCCC3)=NC(N)=NC2Nc2ccc(C)c(C)c2)c1.Cl |
| InChI | InChI=1S/C23H30N6.ClH/c1-15-11-16(2)13-20(12-15)29-22(25-19-8-7-17(3)18(4)14-19)26-21(24)27-23(29)28-9-5-6-10-28;/h7-8,11-14,22,25H,5-6,9-10H2,1-4H3,(H2,24,26);1H |
| InChIKey | PTRYXAPFAFXMRN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |