About N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide
N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide (PubChem CID 171858585) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide |
| PubChem CID | 171858585 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide |
| SMILES | CNCC(O)C(O)c1ccc(NC(C)=O)nc1C |
| InChI | InChI=1S/C12H19N3O3/c1-7-9(12(18)10(17)6-13-3)4-5-11(14-7)15-8(2)16/h4-5,10,12-13,17-18H,6H2,1-3H3,(H,14,15,16) |
| InChIKey | VBEQOPMJPFZDKK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide?
The IUPAC name of N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide (CID 171858585) is N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide.
What is the SMILES notation for N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide?
The canonical SMILES for N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide is CNCC(O)C(O)c1ccc(NC(C)=O)nc1C.
What is the InChIKey of N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide?
The InChIKey is VBEQOPMJPFZDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-7-9(12(18)10(17)6-13-3)4-5-11(14-7)15-8(2)16/h4-5,10,12-13,17-18H,6H2,1-3H3,(H,14,15,16).
What are the key properties of N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide?
N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide has a molecular weight of 253.30 g/mol, XLogP of -0.04, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[1,2-dihydroxy-3-(methylamino)propyl]-6-methyl-2-pyridinyl]acetamide is sourced from PubChem (CID 171858585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).