C11H16BrNO2 — CID 171859224
1-(3-bromo-5-methylphenyl)-3-(methylamino)propane-1,2-diol (PubChem CID 171859224) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-(3-bromo-5-methylphenyl)-3-(methylamino)propane-1,2-diol.
| Compound Name | 1-(3-bromo-5-methylphenyl)-3-(methylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 171859224 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-(3-bromo-5-methylphenyl)-3-(methylamino)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO2/c1-7-3-8(5-9(12)4-7)11(15)10(14)6-13-2/h3-5,10-11,13-15H,6H2,1-2H3 |
| InChIKey | QSDRIOCSJIPUMF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |