4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid

C13H17ClO4 — CID 171862895

IUPAC4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid
SMILESO=C(O)CCCc1ccc(C(O)C(O)CCl)cc1
InChIInChI=1S/C13H17ClO4/c14-8-11(15)13(18)10-6-4-9(5-7-10)2-1-3-12(16)17/h4-7,11,13,15,18H,1-3,8H2,(H,16,17)
InChIKeyUFIOHSKQUHWQNX-UHFFFAOYSA-N
MW272.73 g/mol
LogP1.73
Rot. Bonds7

About 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid

4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid (PubChem CID 171862895) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid.

Molecular Properties

Compound Name4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid
PubChem CID171862895
Molecular FormulaC13H17ClO4
Molecular Weight272.73 g/mol
Exact Mass272.08
IUPAC Name4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid
SMILESO=C(O)CCCc1ccc(C(O)C(O)CCl)cc1
InChIInChI=1S/C13H17ClO4/c14-8-11(15)13(18)10-6-4-9(5-7-10)2-1-3-12(16)17/h4-7,11,13,15,18H,1-3,8H2,(H,16,17)
InChIKeyUFIOHSKQUHWQNX-UHFFFAOYSA-N
XLogP1.73
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.73
LogP ≤ 51.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid?
The IUPAC name of 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid (CID 171862895) is 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid.
What is the SMILES notation for 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid?
The canonical SMILES for 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid is O=C(O)CCCc1ccc(C(O)C(O)CCl)cc1.
What is the InChIKey of 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid?
The InChIKey is UFIOHSKQUHWQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO4/c14-8-11(15)13(18)10-6-4-9(5-7-10)2-1-3-12(16)17/h4-7,11,13,15,18H,1-3,8H2,(H,16,17).
What are the key properties of 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid?
4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid has a molecular weight of 272.73 g/mol, XLogP of 1.73, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-chloro-1,2-dihydroxypropyl)phenyl]butanoic acid is sourced from PubChem (CID 171862895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).