C10H12BrNO4 — CID 171869396
3-(2-bromo-5-methoxyphenyl)-2,3-dihydroxypropanamide (PubChem CID 171869396) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is 3-(2-bromo-5-methoxyphenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2-bromo-5-methoxyphenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869396 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-(2-bromo-5-methoxyphenyl)-2,3-dihydroxypropanamide |
| SMILES | COc1ccc(Br)c(C(O)C(O)C(N)=O)c1 |
| InChI | InChI=1S/C10H12BrNO4/c1-16-5-2-3-7(11)6(4-5)8(13)9(14)10(12)15/h2-4,8-9,13-14H,1H3,(H2,12,15) |
| InChIKey | WPCCNPFHDZYJRW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |