C10H12N2O4S — CID 171870897
ethyl 2-(2-cyano-1,2-dihydroxyethyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 171870897) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is ethyl 2-(2-cyano-1,2-dihydroxyethyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(2-cyano-1,2-dihydroxyethyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 171870897 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | ethyl 2-(2-cyano-1,2-dihydroxyethyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(C(O)C(O)C#N)nc1C |
| InChI | InChI=1S/C10H12N2O4S/c1-3-16-10(15)8-5(2)12-9(17-8)7(14)6(13)4-11/h6-7,13-14H,3H2,1-2H3 |
| InChIKey | OFECHCNKBKINNC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|