C10H11NO3S — CID 169485495
ethyl 2-(3-hydroxyprop-1-ynyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 169485495) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is ethyl 2-(3-hydroxyprop-1-ynyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(3-hydroxyprop-1-ynyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 169485495 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | ethyl 2-(3-hydroxyprop-1-ynyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(C#CCO)nc1C |
| InChI | InChI=1S/C10H11NO3S/c1-3-14-10(13)9-7(2)11-8(15-9)5-4-6-12/h12H,3,6H2,1-2H3 |
| InChIKey | YOLWVMIMMBAUIT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|