C9H13NO4 — CID 171871810
4-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one (PubChem CID 171871810) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one.
| Compound Name | 4-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171871810 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(O)C(O)CCO)cc[nH]1 |
| InChI | InChI=1S/C9H13NO4/c11-4-2-7(12)9(14)6-1-3-10-8(13)5-6/h1,3,5,7,9,11-12,14H,2,4H2,(H,10,13) |
| InChIKey | JJMPYBBTZYYGLT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |