C10H15NO4 — CID 171872091
4-methyl-5-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one (PubChem CID 171872091) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-methyl-5-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one.
| Compound Name | 4-methyl-5-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171872091 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-methyl-5-(1,2,4-trihydroxybutyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(=O)[nH]cc1C(O)C(O)CCO |
| InChI | InChI=1S/C10H15NO4/c1-6-4-9(14)11-5-7(6)10(15)8(13)2-3-12/h4-5,8,10,12-13,15H,2-3H2,1H3,(H,11,14) |
| InChIKey | MJLSMSWWEJEZMV-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |