C12H20N2O4S2 — CID 171875046
tert-butyl N-[5-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 171875046) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl N-[5-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 171875046 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | tert-butyl N-[5-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(C(O)C(O)CCS)s1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-12(2,3)18-11(17)14-10-13-6-8(20-10)9(16)7(15)4-5-19/h6-7,9,15-16,19H,4-5H2,1-3H3,(H,13,14,17) |
| InChIKey | BFLAOFQRBINBKL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|