C12H16N2O6S — CID 22036048
2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]methyl]propanedioic acid (PubChem CID 22036048) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]methyl]propanedioic acid.
| Compound Name | 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 22036048 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]methyl]propanedioic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(CC(C(=O)O)C(=O)O)s1 |
| InChI | InChI=1S/C12H16N2O6S/c1-12(2,3)20-11(19)14-10-13-5-6(21-10)4-7(8(15)16)9(17)18/h5,7H,4H2,1-3H3,(H,15,16)(H,17,18)(H,13,14,19) |
| InChIKey | VZDGPKFVJIDLRM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|