About (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate
(4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate (PubChem CID 17188174) has the molecular formula C20H22Br2O3
and a molecular weight of 470.20 g/mol. Its IUPAC name is (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate.
Molecular Properties
| Compound Name | (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate |
| PubChem CID | 17188174 |
| Molecular Formula | C20H22Br2O3 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(Br)cc2C(C)C)cc1Br |
| InChI | InChI=1S/C20H22Br2O3/c1-4-5-10-24-19-8-6-14(11-17(19)22)20(23)25-18-9-7-15(21)12-16(18)13(2)3/h6-9,11-13H,4-5,10H2,1-3H3 |
| InChIKey | WYMSYLITQVDAHW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate?
The IUPAC name of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate (CID 17188174) is (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate.
What is the SMILES notation for (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate?
The canonical SMILES for (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate is CCCCOc1ccc(C(=O)Oc2ccc(Br)cc2C(C)C)cc1Br.
What is the InChIKey of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate?
The InChIKey is WYMSYLITQVDAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Br2O3/c1-4-5-10-24-19-8-6-14(11-17(19)22)20(23)25-18-9-7-15(21)12-16(18)13(2)3/h6-9,11-13H,4-5,10H2,1-3H3.
What are the key properties of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate?
(4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate has a molecular weight of 470.20 g/mol, XLogP of 6.73, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-butoxybenzoate is sourced from PubChem (CID 17188174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).