About (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate
(4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate (PubChem CID 17188150) has the molecular formula C17H16Br2O2
and a molecular weight of 412.12 g/mol. Its IUPAC name is (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate.
Molecular Properties
| Compound Name | (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate |
| PubChem CID | 17188150 |
| Molecular Formula | C17H16Br2O2 |
| Molecular Weight | 412.12 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(Br)cc2C(C)C)cc1Br |
| InChI | InChI=1S/C17H16Br2O2/c1-10(2)14-9-13(18)6-7-16(14)21-17(20)12-5-4-11(3)15(19)8-12/h4-10H,1-3H3 |
| InChIKey | KRQJIOOWDZDMTJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.12 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate?
The IUPAC name of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate (CID 17188150) is (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate.
What is the SMILES notation for (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate?
The canonical SMILES for (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate is Cc1ccc(C(=O)Oc2ccc(Br)cc2C(C)C)cc1Br.
What is the InChIKey of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate?
The InChIKey is KRQJIOOWDZDMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Br2O2/c1-10(2)14-9-13(18)6-7-16(14)21-17(20)12-5-4-11(3)15(19)8-12/h4-10H,1-3H3.
What are the key properties of (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate?
(4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate has a molecular weight of 412.12 g/mol, XLogP of 5.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-propan-2-ylphenyl) 3-bromo-4-methylbenzoate is sourced from PubChem (CID 17188150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).