C12H15F2NO4 — CID 171890795
4-[1,2-dihydroxy-4-(methylamino)butyl]-3,5-difluorobenzoic acid (PubChem CID 171890795) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 4-[1,2-dihydroxy-4-(methylamino)butyl]-3,5-difluorobenzoic acid.
| Compound Name | 4-[1,2-dihydroxy-4-(methylamino)butyl]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 171890795 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-[1,2-dihydroxy-4-(methylamino)butyl]-3,5-difluorobenzoic acid |
| SMILES | CNCCC(O)C(O)c1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C12H15F2NO4/c1-15-3-2-9(16)11(17)10-7(13)4-6(12(18)19)5-8(10)14/h4-5,9,11,15-17H,2-3H2,1H3,(H,18,19) |
| InChIKey | LLNFPFIZWNPOAU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |