C9H12ClNO4S — CID 171893885
2-(4-chloro-1,2-dihydroxybutyl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 171893885) has the molecular formula C9H12ClNO4S and a molecular weight of 265.72 g/mol. Its IUPAC name is 2-(4-chloro-1,2-dihydroxybutyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-chloro-1,2-dihydroxybutyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 171893885 |
| Molecular Formula | C9H12ClNO4S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(4-chloro-1,2-dihydroxybutyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(C(O)C(O)CCCl)sc1C(=O)O |
| InChI | InChI=1S/C9H12ClNO4S/c1-4-7(9(14)15)16-8(11-4)6(13)5(12)2-3-10/h5-6,12-13H,2-3H2,1H3,(H,14,15) |
| InChIKey | HRJBMDHPXVQDLL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|