C27H28N4O2 — CID 17190243
2-[4-(4-methoxyphenyl)piperazin-1-yl]-7-[(E)-2-phenylethenyl]-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 17190243) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-7-[(E)-2-phenylethenyl]-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-7-[(E)-2-phenylethenyl]-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 17190243 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-7-[(E)-2-phenylethenyl]-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | COc1ccc(N2CCN(c3ncc4c(n3)CC(/C=C/c3ccccc3)CC4=O)CC2)cc1 |
| InChI | InChI=1S/C27H28N4O2/c1-33-23-11-9-22(10-12-23)30-13-15-31(16-14-30)27-28-19-24-25(29-27)17-21(18-26(24)32)8-7-20-5-3-2-4-6-20/h2-12,19,21H,13-18H2,1H3/b8-7+ |
| InChIKey | KVJGRERCXFIDDO-BQYQJAHWSA-N |
| XLogP | 4.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|