C27H30N4O4 — CID 40900113
(7S)-7-(2,4-dimethoxyphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 40900113) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is (7S)-7-(2,4-dimethoxyphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | (7S)-7-(2,4-dimethoxyphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 40900113 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (7S)-7-(2,4-dimethoxyphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | COc1ccc(N2CCN(c3ncc4c(n3)C[C@H](c3ccc(OC)cc3OC)CC4=O)CC2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-33-20-6-4-19(5-7-20)30-10-12-31(13-11-30)27-28-17-23-24(29-27)14-18(15-25(23)32)22-9-8-21(34-2)16-26(22)35-3/h4-9,16-18H,10-15H2,1-3H3/t18-/m0/s1 |
| InChIKey | FOLUIFUTXHQDFZ-SFHVURJKSA-N |
| XLogP | 3.74 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|