C23H20FN3O2 — CID 171902633
6-fluoro-3-isoquinolin-4-yl-7-phenyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902633) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is 6-fluoro-3-isoquinolin-4-yl-7-phenyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 6-fluoro-3-isoquinolin-4-yl-7-phenyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902633 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 6-fluoro-3-isoquinolin-4-yl-7-phenyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NC2CC(c3ccccc3)C(F)CC2C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C23H20FN3O2/c24-19-10-18-20(11-17(19)14-6-2-1-3-7-14)26-23(29)27(22(18)28)21-13-25-12-15-8-4-5-9-16(15)21/h1-9,12-13,17-20H,10-11H2,(H,26,29) |
| InChIKey | KJLVSNPFWQDBQC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |