C14H14F3N3O2 — CID 162370668
1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione (PubChem CID 162370668) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione.
| Compound Name | 1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 162370668 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-pyridin-3-yl-7-(trifluoromethyl)-4a,5,6,7,8,8a-hexahydroquinazoline-2,4-dione |
| SMILES | O=C1NC(=O)N(c2cccnc2)C2CC(C(F)(F)F)CCC12 |
| InChI | InChI=1S/C14H14F3N3O2/c15-14(16,17)8-3-4-10-11(6-8)20(13(22)19-12(10)21)9-2-1-5-18-7-9/h1-2,5,7-8,10-11H,3-4,6H2,(H,19,21,22) |
| InChIKey | YWOLJDWXFZFSHZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |