C21H17ClFN5O4S — CID 171903294
6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-(1,3-dimethyl-2-oxoimidazo[4,5-c]pyridin-7-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171903294) has the molecular formula C21H17ClFN5O4S and a molecular weight of 489.92 g/mol. Its IUPAC name is 6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-(1,3-dimethyl-2-oxoimidazo[4,5-c]pyridin-7-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-(1,3-dimethyl-2-oxoimidazo[4,5-c]pyridin-7-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171903294 |
| Molecular Formula | C21H17ClFN5O4S |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 6-(2-chloro-4-fluoro-5-methoxyphenyl)-3-(1,3-dimethyl-2-oxoimidazo[4,5-c]pyridin-7-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1cc(C2=CC3NC(=O)N(c4cncc5c4n(C)c(=O)n5C)C(=O)C3S2)c(Cl)cc1F |
| InChI | InChI=1S/C21H17ClFN5O4S/c1-26-13-7-24-8-14(17(13)27(2)21(26)31)28-19(29)18-12(25-20(28)30)6-16(33-18)9-4-15(32-3)11(23)5-10(9)22/h4-8,12,18H,1-3H3,(H,25,30) |
| InChIKey | SXJUAVXMLSGGNG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |