C12H7N3S — CID 171904756
3-thia-10,13,16-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,5,7,9,11,13,15-heptaene (PubChem CID 171904756) has the molecular formula C12H7N3S and a molecular weight of 225.28 g/mol. Its IUPAC name is 3-thia-10,13,16-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,5,7,9,11,13,15-heptaene.
| Compound Name | 3-thia-10,13,16-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,5,7,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 171904756 |
| Molecular Formula | C12H7N3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 3-thia-10,13,16-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,5,7,9,11,13,15-heptaene |
| SMILES | C1=NC=c2nc3ccc4c(c3nc21)SCC=4 |
| InChI | InChI=1S/C12H7N3S/c1-2-8-11(12-7(1)3-4-16-12)15-10-6-13-5-9(10)14-8/h1-3,5-6H,4H2 |
| InChIKey | QKYTXRFFLPOEBV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |