C17H18FNO4S — CID 171905484
ethyl 5-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanoate (PubChem CID 171905484) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is ethyl 5-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanoate.
| Compound Name | ethyl 5-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanoate |
|---|---|
| PubChem CID | 171905484 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | ethyl 5-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanoate |
| SMILES | CCOC(=O)CCCCN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H18FNO4S/c1-2-23-15(20)5-3-4-10-19-16(21)14(24-17(19)22)11-12-6-8-13(18)9-7-12/h6-9,11H,2-5,10H2,1H3/b14-11- |
| InChIKey | AZQNQOQKGDGXJP-KAMYIIQDSA-N |
| XLogP | 3.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|