C16H22F3N3O — CID 171907358
1-(4-methylpiperazin-1-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]ethanone (PubChem CID 171907358) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]ethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]ethanone |
|---|---|
| PubChem CID | 171907358 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]ethanone |
| SMILES | CN1CCN(C(=O)CN(C)Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3N3O/c1-20-7-9-22(10-8-20)15(23)12-21(2)11-13-5-3-4-6-14(13)16(17,18)19/h3-6H,7-12H2,1-2H3 |
| InChIKey | LATBIQXRNCIVSQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |