C21H21N3O5 — CID 171908358
2,3-dimethyl-6-(2-oxo-7-propan-2-yloxychromene-3-carbonyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 171908358) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2,3-dimethyl-6-(2-oxo-7-propan-2-yloxychromene-3-carbonyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2,3-dimethyl-6-(2-oxo-7-propan-2-yloxychromene-3-carbonyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171908358 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2,3-dimethyl-6-(2-oxo-7-propan-2-yloxychromene-3-carbonyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C)CN(C(=O)c1cc3ccc(OC(C)C)cc3oc1=O)C2 |
| InChI | InChI=1S/C21H21N3O5/c1-11(2)28-14-6-5-13-7-15(21(27)29-18(13)8-14)20(26)24-9-16-17(10-24)22-12(3)23(4)19(16)25/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | ZRYKNJZHAIEJAW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|