C19H21NO5 — CID 171907057
N-[1-(hydroxymethyl)cyclopent-3-en-1-yl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide (PubChem CID 171907057) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopent-3-en-1-yl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide.
| Compound Name | N-[1-(hydroxymethyl)cyclopent-3-en-1-yl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide |
|---|---|
| PubChem CID | 171907057 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopent-3-en-1-yl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide |
| SMILES | CC(C)Oc1ccc2cc(C(=O)NC3(CO)CC=CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H21NO5/c1-12(2)24-14-6-5-13-9-15(18(23)25-16(13)10-14)17(22)20-19(11-21)7-3-4-8-19/h3-6,9-10,12,21H,7-8,11H2,1-2H3,(H,20,22) |
| InChIKey | OYHRNWSETWTMJY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|