C21H20FNO5 — CID 171908403
N-[1-(4-fluorophenyl)-2-hydroxyethyl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide (PubChem CID 171908403) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-hydroxyethyl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-hydroxyethyl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide |
|---|---|
| PubChem CID | 171908403 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-hydroxyethyl]-2-oxo-7-propan-2-yloxychromene-3-carboxamide |
| SMILES | CC(C)Oc1ccc2cc(C(=O)NC(CO)c3ccc(F)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C21H20FNO5/c1-12(2)27-16-8-5-14-9-17(21(26)28-19(14)10-16)20(25)23-18(11-24)13-3-6-15(22)7-4-13/h3-10,12,18,24H,11H2,1-2H3,(H,23,25) |
| InChIKey | SBZRYGAXJGXLKY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|