C16H14ClNO6 — CID 171910670
methyl (2S,4R)-1-(6-chloro-2-oxochromene-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 171910670) has the molecular formula C16H14ClNO6 and a molecular weight of 351.74 g/mol. Its IUPAC name is methyl (2S,4R)-1-(6-chloro-2-oxochromene-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-(6-chloro-2-oxochromene-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 171910670 |
| Molecular Formula | C16H14ClNO6 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | methyl (2S,4R)-1-(6-chloro-2-oxochromene-3-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O)CN1C(=O)c1cc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C16H14ClNO6/c1-23-16(22)12-6-10(19)7-18(12)14(20)11-5-8-4-9(17)2-3-13(8)24-15(11)21/h2-5,10,12,19H,6-7H2,1H3/t10-,12+/m1/s1 |
| InChIKey | YDGIONVFVDXIJL-PWSUYJOCSA-N |
| XLogP | 1.19 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|