C17H17ClN2O4 — CID 171912685
6-chloro-3-(6-oxa-2,9-diazaspiro[4.5]decane-9-carbonyl)chromen-2-one (PubChem CID 171912685) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 6-chloro-3-(6-oxa-2,9-diazaspiro[4.5]decane-9-carbonyl)chromen-2-one.
| Compound Name | 6-chloro-3-(6-oxa-2,9-diazaspiro[4.5]decane-9-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 171912685 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6-chloro-3-(6-oxa-2,9-diazaspiro[4.5]decane-9-carbonyl)chromen-2-one |
| SMILES | O=C(c1cc2cc(Cl)ccc2oc1=O)N1CCOC2(CCNC2)C1 |
| InChI | InChI=1S/C17H17ClN2O4/c18-12-1-2-14-11(7-12)8-13(16(22)24-14)15(21)20-5-6-23-17(10-20)3-4-19-9-17/h1-2,7-8,19H,3-6,9-10H2 |
| InChIKey | OWVGWJGGSOWDAK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|