C18H19ClN2O5 — CID 171907033
6-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 171907033) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is 6-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | 6-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 171907033 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 6-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(N[C@H]1COC[C@@H]1N1CCOCC1)c1cc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C18H19ClN2O5/c19-12-1-2-16-11(7-12)8-13(18(23)26-16)17(22)20-14-9-25-10-15(14)21-3-5-24-6-4-21/h1-2,7-8,14-15H,3-6,9-10H2,(H,20,22)/t14-,15-/m0/s1 |
| InChIKey | KRPFVIFUKAAOEM-GJZGRUSLSA-N |
| XLogP | 1.28 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|