C20H21N3O3S2 — CID 171913007
1-[5-(3-aminophenyl)thiophen-2-yl]sulfonyl-4-pyridin-3-ylpiperidin-4-ol (PubChem CID 171913007) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[5-(3-aminophenyl)thiophen-2-yl]sulfonyl-4-pyridin-3-ylpiperidin-4-ol.
| Compound Name | 1-[5-(3-aminophenyl)thiophen-2-yl]sulfonyl-4-pyridin-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 171913007 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[5-(3-aminophenyl)thiophen-2-yl]sulfonyl-4-pyridin-3-ylpiperidin-4-ol |
| SMILES | Nc1cccc(-c2ccc(S(=O)(=O)N3CCC(O)(c4cccnc4)CC3)s2)c1 |
| InChI | InChI=1S/C20H21N3O3S2/c21-17-5-1-3-15(13-17)18-6-7-19(27-18)28(25,26)23-11-8-20(24,9-12-23)16-4-2-10-22-14-16/h1-7,10,13-14,24H,8-9,11-12,21H2 |
| InChIKey | JPPZEIQQNYHIOM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|