C18H19N5O2S2 — CID 171912902
2-cyclopropyl-7-(5-pyridin-3-ylthiophen-2-yl)sulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine (PubChem CID 171912902) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 2-cyclopropyl-7-(5-pyridin-3-ylthiophen-2-yl)sulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine.
| Compound Name | 2-cyclopropyl-7-(5-pyridin-3-ylthiophen-2-yl)sulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 171912902 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-cyclopropyl-7-(5-pyridin-3-ylthiophen-2-yl)sulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
| SMILES | O=S(=O)(c1ccc(-c2cccnc2)s1)N1CCc2nc(C3CC3)nn2CC1 |
| InChI | InChI=1S/C18H19N5O2S2/c24-27(25,17-6-5-15(26-17)14-2-1-8-19-12-14)22-9-7-16-20-18(13-3-4-13)21-23(16)11-10-22/h1-2,5-6,8,12-13H,3-4,7,9-11H2 |
| InChIKey | XABOUCNOWFQMFQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |