C18H24N4O3S — CID 162627555
7-benzylsulfonyl-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine (PubChem CID 162627555) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 7-benzylsulfonyl-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine.
| Compound Name | 7-benzylsulfonyl-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 162627555 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 7-benzylsulfonyl-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCc2nc(C3CCOCC3)nn2CC1 |
| InChI | InChI=1S/C18H24N4O3S/c23-26(24,14-15-4-2-1-3-5-15)21-9-6-17-19-18(20-22(17)11-10-21)16-7-12-25-13-8-16/h1-5,16H,6-14H2 |
| InChIKey | SRMCGWDTNJDQSE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |