C17H15N3O2S2 — CID 11639028
N-(2-cyclopropylpyrimidin-4-yl)-5-phenylthiophene-2-sulfonamide (PubChem CID 11639028) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(2-cyclopropylpyrimidin-4-yl)-5-phenylthiophene-2-sulfonamide.
| Compound Name | N-(2-cyclopropylpyrimidin-4-yl)-5-phenylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11639028 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-(2-cyclopropylpyrimidin-4-yl)-5-phenylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccnc(C2CC2)n1)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H15N3O2S2/c21-24(22,20-15-10-11-18-17(19-15)13-6-7-13)16-9-8-14(23-16)12-4-2-1-3-5-12/h1-5,8-11,13H,6-7H2,(H,18,19,20) |
| InChIKey | AFQCVOKNLJMPAF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |