C22H30N4O2 — CID 171913109
3-methyl-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one (PubChem CID 171913109) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 3-methyl-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one.
| Compound Name | 3-methyl-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 171913109 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 3-methyl-4-[2-(4-piperidin-1-ylbutoxy)phenyl]-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-6-one |
| SMILES | Cc1[nH]nc2c1C(c1ccccc1OCCCCN1CCCCC1)CC(=O)N2 |
| InChI | InChI=1S/C22H30N4O2/c1-16-21-18(15-20(27)23-22(21)25-24-16)17-9-3-4-10-19(17)28-14-8-7-13-26-11-5-2-6-12-26/h3-4,9-10,18H,2,5-8,11-15H2,1H3,(H2,23,24,25,27) |
| InChIKey | MPMNSOILQWXKBE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|